Corresponding foreign brands: United Carbon: A-1120, Shin-Etsu, Japan: KBM-603
Main chemical composition: NH2(CH2)2NH(CH2)3Si(OCH3)3
Molecular weight: 222.4
Is a bifunctional silane. Used to strengthen the adhesion between resin and inorganic coating, plastic coating and inorganic filler surface.
Physical and chemical properties:
Appearance | light yellow transparent liquid |
Density: ρ (25/25℃) | 1.030 |
Refractive index n D 25℃ | 1.427 |
Boiling point (760mmHg) | 259℃ |
Flash point | 88℃ |
Soluble | organic solvents such as benzene and ether, and reacts with acetone, titanium tetrachloride and water. |
Use:
1. As an adhesion promoter, this product is suitable for polysulfide, polyvinyl chloride paste, silicone two-component, polyurethane and epoxy resin bonding and sealing agent.
2. As an additive for phenolic and epoxy moldings.
3. As a component of latex paint, adhesive and sealant.
4. Used as an adhesion promoter for one-component silane polyurethane adhesives based on organofunctional silane SPURSM technology.
Features and functions:
Characteristic | Features |
Polyamino functional group | Provides reactive sites for amino-reactive resins to improve substrate wettability |
Bifunctional silane | It has significant adhesion to inorganic substrate materials, such as metal and glass. When used in adhesives or sealants based on SPUR SM technology, it has significant adhesion to plastics. |