
Basic information:
Product code: KH-793
Chemical name: N-(2-aminoethyl)-3-aminopropyltriethoxysilane
Synonymous name: n-aminoethyl-3-aminopropyltriethoxy Silane, n-[3-(triethoxysilyl)propyl]ethylenediamine, 3-(2-aminoethylamino)propyltriethoxysilane, 3-(2-aminoethylamine) Propyltriethoxysilane
Molecular formula: NH2(CH2)2NH(CH2)3Si(OC2H5)3
Structural formula:
Molecular weight: 264.44
CAS number: 5089-72-5
EINECS number: 225-806-1
Physical and chemical properties:
| Appearance | colorless or slightly yellow transparent liquid |
| Boiling point: | 114-118°C |
| Density (ρ20)g/cm3: | 0.9650±0.005 |
| Refractive index (n25D): | 1.4360±0.005 |
| Soluble | benzene, ethyl acetate, and reacts with water |
Application:
Main application areas: Adhesive resin filler coating casting
Uses:
1. Mainly used to couple organic high polymer and inorganic substance to make the chemical bond of the two into a whole, to improve various physical and mechanical properties, electrical properties, water resistance, aging resistance, etc. of the polymer, suitable for coupling The linked polymers include thermosetting resins such as epoxy, phenolic, polyurethane, melamine, butyronitrile phenolic; hot-melt resins such as polystyrene, polyvinyl chloride, polyamide; elastomer polysulfide rubber , Polyurethane rubber, etc.
2. Mainly improve the performance of epoxy, phenolic, melamine, furan and other resin laminates. It is also effective for polypropylene, polyethylene, polyacrylic acid vinegar, silicone, polyamide, polycarbonate, polyvinyl chloride.
3. It is used as a glass fiber finishing agent, and is also widely used in silicon-containing substances such as glass beads, white carbon black, talc, mica, clay, and fly ash.
Standard packaging: 5L, 10L, 25L, 200L PE plastic drum or 1000L IBC drum.
Storage: sealed and stored in a cool, dry and ventilated place, moisture-proof and waterproof, away from fire and heat sources.