N-β-(aminoethyl)-aminopropyltrimethoxysilane KH-792
Corresponding foreign brands: American Union Carbon: A-1120, Japan Shin-Etsu: KBM-603
Main chemical composition: NH2(CH2)2NH(CH2)3Si(OCH3)3
Is a bifunctional silane. Used to strengthen the adhesion between resin and inorganic coating, plastic coating and inorganic filler surface.
Physical and chemical properties: This product is colorless to light yellow transparent liquid, density: ρ (25/25℃): 1.030, refractive index n D 25℃: 1.427, boiling point (760mmHg): 259℃, flash point: 88℃, molecular weight222.4, soluble in organic solvents such as benzene and ether, reacting with acetone, titanium tetrachloride and water.
Use:
1. As an adhesion promoter, this product is suitable for polysulfide, polyvinyl chloride paste, silicone two-component, polyurethane and epoxy resin bonding and sealing agent.
2. As an additive for phenolic and epoxy moldings.
3. As a component of latex paint, adhesive and sealant.
4. Used as an adhesion promoter for one-component silane polyurethane adhesives based on organofunctional silane SPURSM technology.
Features and functions:
| characteristic | Features |
| Polyamino functional group | Provides reactive sites for amino-reactive resins to improve substrate wettability |
| Bifunctional silane | It has significant adhesion to inorganic substrate materials, such as metal and glass. When used in adhesives or sealants based on SPUR SM technology, it has significant adhesion to plastics. |