N-β-(aminoethyl)-γ-aminopropyltrimethoxysilane KH-792
Corresponding foreign brands: United Carbon: A-1120, Shin-Etsu, Japan: KBM-603
Main chemical composition: NH2(CH2)2NH(CH2)3Si(OCH3)3
Molecular weight: 222.4
Is a bifunctional silane. Used to strengthen the adhesion between resin and inorganic coating, plastic coating and inorganic filler surface.
Physical and chemical properties:
| Appearance | light yellow transparent liquid |
| Density: ρ (25/25℃) | 1.030 |
| Refractive index n D 25℃ | 1.427 |
| Boiling point (760mmHg) | 259℃ |
| Flash point | 88℃ |
| Soluble | organic solvents such as benzene and ether, and reacts with acetone, titanium tetrachloride and water. |
Use:
1. As an adhesion promoter, this product is suitable for polysulfide, polyvinyl chloride paste, silicone two-component, polyurethane and epoxy resin bonding and sealing agent.
2. As an additive for phenolic and epoxy moldings.
3. As a component of latex paint, adhesive and sealant.
4. Used as an adhesion promoter for one-component silane polyurethane adhesives based on organofunctional silane SPURSM technology.
Features and functions:
| Characteristic | Features |
| Polyamino functional group | Provides reactive sites for amino-reactive resins to improve substrate wettability |
| Bifunctional silane | It has significant adhesion to inorganic substrate materials, such as metal and glass. When used in adhesives or sealants based on SPUR SM technology, it has significant adhesion to plastics. |
